C14H24N4O3S — CID 111605081
1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 111605081) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111605081 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(N)(=O)=O)cc1)NCC(C)(C)OC |
| InChI | InChI=1S/C14H24N4O3S/c1-14(2,21-4)10-18-13(16-3)17-9-11-5-7-12(8-6-11)22(15,19)20/h5-8H,9-10H2,1-4H3,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | MFVRKOQRSWREGJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|