C14H13N3O5S — CID 10314877
N-[(4-nitrophenyl)methyl]-4-sulfamoylbenzamide (PubChem CID 10314877) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methyl]-4-sulfamoylbenzamide.
| Compound Name | N-[(4-nitrophenyl)methyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 10314877 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[(4-nitrophenyl)methyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H13N3O5S/c15-23(21,22)13-7-3-11(4-8-13)14(18)16-9-10-1-5-12(6-2-10)17(19)20/h1-8H,9H2,(H,16,18)(H2,15,21,22) |
| InChIKey | ZVPSJVRRYDYIEK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|