C18H22IN5O4S — CID 136920579
1-cyclopropyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 136920579) has the molecular formula C18H22IN5O4S and a molecular weight of 531.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136920579 |
| Molecular Formula | C18H22IN5O4S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 1-cyclopropyl-3-[(4-nitrophenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | I.NS(=O)(=O)c1ccc(C/N=C(\NCc2ccc([N+](=O)[O-])cc2)NC2CC2)cc1 |
| InChI | InChI=1S/C18H21N5O4S.HI/c19-28(26,27)17-9-3-14(4-10-17)12-21-18(22-15-5-6-15)20-11-13-1-7-16(8-2-13)23(24)25;/h1-4,7-10,15H,5-6,11-12H2,(H2,19,26,27)(H2,20,21,22);1H |
| InChIKey | SUFORUFOBGOGIC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|