C16H27IN4O2S — CID 111255804
2-methyl-1-(4-methylcyclohexyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111255804) has the molecular formula C16H27IN4O2S and a molecular weight of 466.39 g/mol. Its IUPAC name is 2-methyl-1-(4-methylcyclohexyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(4-methylcyclohexyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111255804 |
| Molecular Formula | C16H27IN4O2S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-methyl-1-(4-methylcyclohexyl)-3-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)cc1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C16H26N4O2S.HI/c1-12-3-7-14(8-4-12)20-16(18-2)19-11-13-5-9-15(10-6-13)23(17,21)22;/h5-6,9-10,12,14H,3-4,7-8,11H2,1-2H3,(H2,17,21,22)(H2,18,19,20);1H |
| InChIKey | FMEZVARATKJBCO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|