C16H22N2O3S — CID 75364867
2-(4-methylcyclohexylidene)-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 75364867) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-(4-methylcyclohexylidene)-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(4-methylcyclohexylidene)-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 75364867 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(4-methylcyclohexylidene)-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | CC1CCC(=CC(=O)NCc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C16H22N2O3S/c1-12-2-4-13(5-3-12)10-16(19)18-11-14-6-8-15(9-7-14)22(17,20)21/h6-10,12H,2-5,11H2,1H3,(H,18,19)(H2,17,20,21)/b13-10- |
| InChIKey | MJGFKCXSCFYWNR-RAXLEYEMSA-N |
| XLogP | 2.09 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|