C19H25IN4O3S — CID 111190367
1-(4-hydroxycyclohexyl)-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111190367) has the molecular formula C19H25IN4O3S and a molecular weight of 516.41 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(4-hydroxycyclohexyl)-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111190367 |
| Molecular Formula | C19H25IN4O3S |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.O=[N+]([O-])c1ccc(C/N=C(\NCc2cccs2)NC2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O3S.HI/c24-17-9-5-15(6-10-17)22-19(21-13-18-2-1-11-27-18)20-12-14-3-7-16(8-4-14)23(25)26;/h1-4,7-8,11,15,17,24H,5-6,9-10,12-13H2,(H2,20,21,22);1H |
| InChIKey | BGJOIJGTZJXMEY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|