C20H19FN4O2S — CID 111266043
1-[(2-fluorophenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111266043) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111266043 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | O=[N+]([O-])c1ccc(C/N=C(\NCc2cccs2)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C20H19FN4O2S/c21-19-6-2-1-4-16(19)13-23-20(24-14-18-5-3-11-28-18)22-12-15-7-9-17(10-8-15)25(26)27/h1-11H,12-14H2,(H2,22,23,24) |
| InChIKey | WPRQHLGKDTYZKG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|