C16H22IN5O4S2 — CID 111906960
1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111906960) has the molecular formula C16H22IN5O4S2 and a molecular weight of 539.42 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111906960 |
| Molecular Formula | C16H22IN5O4S2 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CS(=O)(=O)NCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCc1cccs1.I |
| InChI | InChI=1S/C16H21N5O4S2.HI/c1-27(24,25)20-9-8-17-16(19-12-15-3-2-10-26-15)18-11-13-4-6-14(7-5-13)21(22)23;/h2-7,10,20H,8-9,11-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | CIDNEBMKUHPODX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|