C14H22IN5O4S — CID 111495071
1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111495071) has the molecular formula C14H22IN5O4S and a molecular weight of 483.33 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111495071 |
| Molecular Formula | C14H22IN5O4S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-2-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCCNS(C)(=O)=O.I |
| InChI | InChI=1S/C14H21N5O4S.HI/c1-3-8-15-14(16-9-10-18-24(2,22)23)17-11-12-4-6-13(7-5-12)19(20)21;/h3-7,18H,1,8-11H2,2H3,(H2,15,16,17);1H |
| InChIKey | RAPPFKXBFNKBCX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|