C16H21N3O2S2 — CID 111257645
1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111257645) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111257645 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(C)(=O)=O)cc1)NCc1cccs1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-3-17-16(19-12-14-5-4-10-22-14)18-11-13-6-8-15(9-7-13)23(2,20)21/h4-10H,3,11-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | CTDFDTXCYVDWCZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|