C17H24IN3O3S — CID 111259096
1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111259096) has the molecular formula C17H24IN3O3S and a molecular weight of 477.37 g/mol. Its IUPAC name is 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111259096 |
| Molecular Formula | C17H24IN3O3S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)NCc1cccs1.I |
| InChI | InChI=1S/C17H23N3O3S.HI/c1-4-18-17(20-11-13-6-5-7-24-13)19-10-12-8-14(22-2)16(21)15(9-12)23-3;/h5-9,21H,4,10-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | NJYQQTREWJCASR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|