C19H25ClIN3O3 — CID 111131035
1-[(4-chlorophenyl)methyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111131035) has the molecular formula C19H25ClIN3O3 and a molecular weight of 505.78 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111131035 |
| Molecular Formula | C19H25ClIN3O3 |
| Molecular Weight | 505.78 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)NCc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C19H24ClN3O3.HI/c1-4-21-19(22-11-13-5-7-15(20)8-6-13)23-12-14-9-16(25-2)18(24)17(10-14)26-3;/h5-10,24H,4,11-12H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | REKYZCXKYXFFQU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|