C15H23F3IN3O3 — CID 109473702
1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473702) has the molecular formula C15H23F3IN3O3 and a molecular weight of 477.27 g/mol. Its IUPAC name is 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473702 |
| Molecular Formula | C15H23F3IN3O3 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 1-ethyl-2-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(O)c(OC)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H22F3N3O3.HI/c1-4-19-14(20-6-5-15(16,17)18)21-9-10-7-11(23-2)13(22)12(8-10)24-3;/h7-8,22H,4-6,9H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | RVTMPGDSHZIQDZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|