C15H25N5O3S2 — CID 111346205
N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111346205) has the molecular formula C15H25N5O3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111346205 |
| Molecular Formula | C15H25N5O3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-methylsulfanylethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | CSCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C15H25N5O3S2/c1-20(2)14(21)11-19-15(17-8-9-24-3)18-10-12-4-6-13(7-5-12)25(16,22)23/h4-7H,8-11H2,1-3H3,(H2,16,22,23)(H2,17,18,19) |
| InChIKey | USJVJAISCYYUBS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|