C20H26FN5O3S — CID 111364825
2-[[N'-[(3-fluoro-4-methylphenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111364825) has the molecular formula C20H26FN5O3S and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-[[N'-[(3-fluoro-4-methylphenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(3-fluoro-4-methylphenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111364825 |
| Molecular Formula | C20H26FN5O3S |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[[N'-[(3-fluoro-4-methylphenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | Cc1ccc(C/N=C(\NCC(=O)N(C)C)NCc2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C20H26FN5O3S/c1-14-4-5-16(10-18(14)21)12-24-20(25-13-19(27)26(2)3)23-11-15-6-8-17(9-7-15)30(22,28)29/h4-10H,11-13H2,1-3H3,(H2,22,28,29)(H2,23,24,25) |
| InChIKey | WXSRNPPCGMPRFD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|