C15H26IN5O4S — CID 110941873
2-[[N-(2-methoxyethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110941873) has the molecular formula C15H26IN5O4S and a molecular weight of 499.38 g/mol. Its IUPAC name is 2-[[N-(2-methoxyethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-(2-methoxyethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110941873 |
| Molecular Formula | C15H26IN5O4S |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-[[N-(2-methoxyethyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C15H25N5O4S.HI/c1-20(2)14(21)11-19-15(17-8-9-24-3)18-10-12-4-6-13(7-5-12)25(16,22)23;/h4-7H,8-11H2,1-3H3,(H2,16,22,23)(H2,17,18,19);1H |
| InChIKey | FCHFPWUDDSWAIC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|