C11H19N5O3S — CID 116511985
1-amino-3-(2-methoxyethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 116511985) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-amino-3-(2-methoxyethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-amino-3-(2-methoxyethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 116511985 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-amino-3-(2-methoxyethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | COCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NN |
| InChI | InChI=1S/C11H19N5O3S/c1-19-7-6-14-11(16-12)15-8-9-2-4-10(5-3-9)20(13,17)18/h2-5H,6-8,12H2,1H3,(H2,13,17,18)(H2,14,15,16) |
| InChIKey | OFJOKASLMOUEAT-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|