C11H18N4O — CID 116511560
1-amino-2-benzyl-3-(2-methoxyethyl)guanidine (PubChem CID 116511560) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-amino-2-benzyl-3-(2-methoxyethyl)guanidine.
| Compound Name | 1-amino-2-benzyl-3-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 116511560 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-amino-2-benzyl-3-(2-methoxyethyl)guanidine |
| SMILES | COCCN/C(=N\Cc1ccccc1)NN |
| InChI | InChI=1S/C11H18N4O/c1-16-8-7-13-11(15-12)14-9-10-5-3-2-4-6-10/h2-6H,7-9,12H2,1H3,(H2,13,14,15) |
| InChIKey | RQQKIFUVWPZKTB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|