C20H34IN5O4S — CID 110034976
2-[[N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034976) has the molecular formula C20H34IN5O4S and a molecular weight of 567.49 g/mol. Its IUPAC name is 2-[[N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034976 |
| Molecular Formula | C20H34IN5O4S |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 2-[[N-[[1-(2-methoxyethyl)cyclobutyl]methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCC1(CN/C(=N/Cc2ccc(S(N)(=O)=O)cc2)NCC(=O)N(C)C)CCC1.I |
| InChI | InChI=1S/C20H33N5O4S.HI/c1-25(2)18(26)14-23-19(24-15-20(9-4-10-20)11-12-29-3)22-13-16-5-7-17(8-6-16)30(21,27)28;/h5-8H,4,9-15H2,1-3H3,(H2,21,27,28)(H2,22,23,24);1H |
| InChIKey | PXKFWFGSANWMKJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|