C19H28N4O4 — CID 110021033
4-hydroxy-N'-[(4-nitrophenyl)methyl]-N-(oxan-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 110021033) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-hydroxy-N'-[(4-nitrophenyl)methyl]-N-(oxan-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | 4-hydroxy-N'-[(4-nitrophenyl)methyl]-N-(oxan-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110021033 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 4-hydroxy-N'-[(4-nitrophenyl)methyl]-N-(oxan-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | O=[N+]([O-])c1ccc(C/N=C(\NCC2CCCCO2)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O4/c24-17-8-10-22(11-9-17)19(21-14-18-3-1-2-12-27-18)20-13-15-4-6-16(7-5-15)23(25)26/h4-7,17-18,24H,1-3,8-14H2,(H,20,21) |
| InChIKey | ZIPZQGFNPZIFDV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|