C22H28N6O3 — CID 111541254
N'-[(4-nitrophenyl)methyl]-N-(oxolan-2-ylmethyl)-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111541254) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is N'-[(4-nitrophenyl)methyl]-N-(oxolan-2-ylmethyl)-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[(4-nitrophenyl)methyl]-N-(oxolan-2-ylmethyl)-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111541254 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N'-[(4-nitrophenyl)methyl]-N-(oxolan-2-ylmethyl)-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | O=[N+]([O-])c1ccc(C/N=C(\NCC2CCCO2)N2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C22H28N6O3/c29-28(30)19-8-6-18(7-9-19)16-24-22(25-17-20-4-3-15-31-20)27-13-11-26(12-14-27)21-5-1-2-10-23-21/h1-2,5-10,20H,3-4,11-17H2,(H,24,25) |
| InChIKey | RPUJVRBMENRSBU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|