C20H25IN6O2 — CID 111221570
N'-[(4-nitrophenyl)methyl]-N-prop-2-enyl-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111221570) has the molecular formula C20H25IN6O2 and a molecular weight of 508.36 g/mol. Its IUPAC name is N'-[(4-nitrophenyl)methyl]-N-prop-2-enyl-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-nitrophenyl)methyl]-N-prop-2-enyl-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111221570 |
| Molecular Formula | C20H25IN6O2 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N'-[(4-nitrophenyl)methyl]-N-prop-2-enyl-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C20H24N6O2.HI/c1-2-10-22-20(23-16-17-6-8-18(9-7-17)26(27)28)25-14-12-24(13-15-25)19-5-3-4-11-21-19;/h2-9,11H,1,10,12-16H2,(H,22,23);1H |
| InChIKey | YRXVCACEMHOCMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|