C18H23IN4O4 — CID 111542321
N-(furan-2-ylmethyl)-4-hydroxy-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111542321) has the molecular formula C18H23IN4O4 and a molecular weight of 486.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-hydroxy-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(furan-2-ylmethyl)-4-hydroxy-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111542321 |
| Molecular Formula | C18H23IN4O4 |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-hydroxy-N'-[(4-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.O=[N+]([O-])c1ccc(C/N=C(\NCc2ccco2)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C18H22N4O4.HI/c23-16-7-9-21(10-8-16)18(20-13-17-2-1-11-26-17)19-12-14-3-5-15(6-4-14)22(24)25;/h1-6,11,16,23H,7-10,12-13H2,(H,19,20);1H |
| InChIKey | QQIJIJDXWVPXNU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|