C22H27N5O5 — CID 111542008
N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111542008) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111542008 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | O=C(C1CCCO1)N1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCc2ccco2)CC1 |
| InChI | InChI=1S/C22H27N5O5/c28-21(20-4-2-14-32-20)25-9-11-26(12-10-25)22(24-16-19-3-1-13-31-19)23-15-17-5-7-18(8-6-17)27(29)30/h1,3,5-8,13,20H,2,4,9-12,14-16H2,(H,23,24) |
| InChIKey | CFZPECSJTPCHHE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|