C20H25IN4O5 — CID 111541539
methyl 1-[N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111541539) has the molecular formula C20H25IN4O5 and a molecular weight of 528.35 g/mol. Its IUPAC name is methyl 1-[N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111541539 |
| Molecular Formula | C20H25IN4O5 |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | methyl 1-[N-(furan-2-ylmethyl)-N'-[(4-nitrophenyl)methyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | COC(=O)C1CCN(/C(=N/Cc2ccc([N+](=O)[O-])cc2)NCc2ccco2)CC1.I |
| InChI | InChI=1S/C20H24N4O5.HI/c1-28-19(25)16-8-10-23(11-9-16)20(22-14-18-3-2-12-29-18)21-13-15-4-6-17(7-5-15)24(26)27;/h2-7,12,16H,8-11,13-14H2,1H3,(H,21,22);1H |
| InChIKey | NQLVBFFYVPPEJN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|