C21H31IN6O5 — CID 110020951
N,N-dimethyl-2-[[N-[(4-nitrophenyl)methyl]-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide (PubChem CID 110020951) has the molecular formula C21H31IN6O5 and a molecular weight of 574.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-[(4-nitrophenyl)methyl]-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N-[(4-nitrophenyl)methyl]-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110020951 |
| Molecular Formula | C21H31IN6O5 |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | N,N-dimethyl-2-[[N-[(4-nitrophenyl)methyl]-C-[4-(oxolane-2-carbonyl)piperazin-1-yl]carbonimidoyl]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C21H30N6O5.HI/c1-24(2)19(28)15-23-21(22-14-16-5-7-17(8-6-16)27(30)31)26-11-9-25(10-12-26)20(29)18-4-3-13-32-18;/h5-8,18H,3-4,9-15H2,1-2H3,(H,22,23);1H |
| InChIKey | RYBPOMWRIMXLFB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|