C18H20N4O3 — CID 132838246
N'-benzyl-N-(4-nitrophenyl)morpholine-4-carboximidamide (PubChem CID 132838246) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N'-benzyl-N-(4-nitrophenyl)morpholine-4-carboximidamide.
| Compound Name | N'-benzyl-N-(4-nitrophenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 132838246 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N'-benzyl-N-(4-nitrophenyl)morpholine-4-carboximidamide |
| SMILES | O=[N+]([O-])c1ccc(N/C(=N/Cc2ccccc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H20N4O3/c23-22(24)17-8-6-16(7-9-17)20-18(21-10-12-25-13-11-21)19-14-15-4-2-1-3-5-15/h1-9H,10-14H2,(H,19,20) |
| InChIKey | YZPVYIJCGRVSFI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|