C12H13F3N4O5S — CID 23228475
N-(4-nitrophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide (PubChem CID 23228475) has the molecular formula C12H13F3N4O5S and a molecular weight of 382.32 g/mol. Its IUPAC name is N-(4-nitrophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide.
| Compound Name | N-(4-nitrophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 23228475 |
| Molecular Formula | C12H13F3N4O5S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-(4-nitrophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide |
| SMILES | O=[N+]([O-])c1ccc(N/C(=N/S(=O)(=O)C(F)(F)F)N2CCOCC2)cc1 |
| InChI | InChI=1S/C12H13F3N4O5S/c13-12(14,15)25(22,23)17-11(18-5-7-24-8-6-18)16-9-1-3-10(4-2-9)19(20)21/h1-4H,5-8H2,(H,16,17) |
| InChIKey | BYDUFVCQRRHXGK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|