C12H13ClF3N3O3S — CID 177488704
N-(4-chlorophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide (PubChem CID 177488704) has the molecular formula C12H13ClF3N3O3S and a molecular weight of 371.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide.
| Compound Name | N-(4-chlorophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 177488704 |
| Molecular Formula | C12H13ClF3N3O3S |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-(4-chlorophenyl)-N'-(trifluoromethylsulfonyl)morpholine-4-carboximidamide |
| SMILES | O=S(=O)(/N=C(/Nc1ccc(Cl)cc1)N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C12H13ClF3N3O3S/c13-9-1-3-10(4-2-9)17-11(19-5-7-22-8-6-19)18-23(20,21)12(14,15)16/h1-4H,5-8H2,(H,17,18) |
| InChIKey | LOSZATXOFJXCCN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|