C14H16F2N2O6S — CID 21177670
(4-acetamidophenyl) 1,1-difluoro-2-morpholin-4-yl-2-oxoethanesulfonate (PubChem CID 21177670) has the molecular formula C14H16F2N2O6S and a molecular weight of 378.35 g/mol. Its IUPAC name is (4-acetamidophenyl) 1,1-difluoro-2-morpholin-4-yl-2-oxoethanesulfonate.
| Compound Name | (4-acetamidophenyl) 1,1-difluoro-2-morpholin-4-yl-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 21177670 |
| Molecular Formula | C14H16F2N2O6S |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (4-acetamidophenyl) 1,1-difluoro-2-morpholin-4-yl-2-oxoethanesulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)C(F)(F)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C14H16F2N2O6S/c1-10(19)17-11-2-4-12(5-3-11)24-25(21,22)14(15,16)13(20)18-6-8-23-9-7-18/h2-5H,6-9H2,1H3,(H,17,19) |
| InChIKey | PJWJWUUBFKPNQW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|