C11H8Cl3F4NO5S — CID 3356438
(4-acetamidophenyl) 1,1,2,2-tetrafluoro-2-(trichloromethoxy)ethanesulfonate (PubChem CID 3356438) has the molecular formula C11H8Cl3F4NO5S and a molecular weight of 448.61 g/mol. Its IUPAC name is (4-acetamidophenyl) 1,1,2,2-tetrafluoro-2-(trichloromethoxy)ethanesulfonate.
| Compound Name | (4-acetamidophenyl) 1,1,2,2-tetrafluoro-2-(trichloromethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 3356438 |
| Molecular Formula | C11H8Cl3F4NO5S |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 446.91 |
| IUPAC Name | (4-acetamidophenyl) 1,1,2,2-tetrafluoro-2-(trichloromethoxy)ethanesulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)OC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H8Cl3F4NO5S/c1-6(20)19-7-2-4-8(5-3-7)23-25(21,22)10(17,18)9(15,16)24-11(12,13)14/h2-5H,1H3,(H,19,20) |
| InChIKey | NQYDDBVOBBJPHD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|