C9H11NO2 — CID 167581919
N-(2,3-dideuterio-4-methoxyphenyl)acetamide (PubChem CID 167581919) has the molecular formula C9H11NO2 and a molecular weight of 167.20 g/mol. Its IUPAC name is N-(2,3-dideuterio-4-methoxyphenyl)acetamide.
| Compound Name | N-(2,3-dideuterio-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 167581919 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-(2,3-dideuterio-4-methoxyphenyl)acetamide |
| SMILES | [2H]c1c(NC(C)=O)ccc(OC)c1[2H] |
| InChI | InChI=1S/C9H11NO2/c1-7(11)10-8-3-5-9(12-2)6-4-8/h3-6H,1-2H3,(H,10,11)/i3D,5D |
| InChIKey | XVAIDCNLVLTVFM-XBTCESIDSA-N |
| XLogP | 1.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |