C18H12F9NO5S — CID 15419132
[4-(phenylmethoxycarbonylamino)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 15419132) has the molecular formula C18H12F9NO5S and a molecular weight of 525.35 g/mol. Its IUPAC name is [4-(phenylmethoxycarbonylamino)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [4-(phenylmethoxycarbonylamino)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 15419132 |
| Molecular Formula | C18H12F9NO5S |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | [4-(phenylmethoxycarbonylamino)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=C(Nc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H12F9NO5S/c19-15(20,17(23,24)25)16(21,22)18(26,27)34(30,31)33-13-8-6-12(7-9-13)28-14(29)32-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,28,29) |
| InChIKey | XVPYMHCXGNTREQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|