C19H14F3NO5S — CID 58862455
[8-(phenylmethoxycarbonylamino)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 58862455) has the molecular formula C19H14F3NO5S and a molecular weight of 425.38 g/mol. Its IUPAC name is [8-(phenylmethoxycarbonylamino)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-(phenylmethoxycarbonylamino)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58862455 |
| Molecular Formula | C19H14F3NO5S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [8-(phenylmethoxycarbonylamino)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C(Nc1cccc2ccc(OS(=O)(=O)C(F)(F)F)cc12)OCc1ccccc1 |
| InChI | InChI=1S/C19H14F3NO5S/c20-19(21,22)29(25,26)28-15-10-9-14-7-4-8-17(16(14)11-15)23-18(24)27-12-13-5-2-1-3-6-13/h1-11H,12H2,(H,23,24) |
| InChIKey | HGAXKKSLWABYJC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|