C18H15NO5S — CID 154164204
6-(phenylmethoxycarbonylamino)naphthalene-1-sulfonic acid (PubChem CID 154164204) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is 6-(phenylmethoxycarbonylamino)naphthalene-1-sulfonic acid.
| Compound Name | 6-(phenylmethoxycarbonylamino)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 154164204 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 6-(phenylmethoxycarbonylamino)naphthalene-1-sulfonic acid |
| SMILES | O=C(Nc1ccc2c(S(=O)(=O)O)cccc2c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H15NO5S/c20-18(24-12-13-5-2-1-3-6-13)19-15-9-10-16-14(11-15)7-4-8-17(16)25(21,22)23/h1-11H,12H2,(H,19,20)(H,21,22,23) |
| InChIKey | HSGGGBRDRXTROS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|