C21H19N3O5S — CID 139878379
benzyl N-[3-(phenylcarbamoylsulfamoyl)phenyl]carbamate (PubChem CID 139878379) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is benzyl N-[3-(phenylcarbamoylsulfamoyl)phenyl]carbamate.
| Compound Name | benzyl N-[3-(phenylcarbamoylsulfamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 139878379 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | benzyl N-[3-(phenylcarbamoylsulfamoyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1)NS(=O)(=O)c1cccc(NC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3O5S/c25-20(22-17-10-5-2-6-11-17)24-30(27,28)19-13-7-12-18(14-19)23-21(26)29-15-16-8-3-1-4-9-16/h1-14H,15H2,(H,23,26)(H2,22,24,25) |
| InChIKey | UJYXOEALOYCYFB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |