C20H19ClN2O2 — CID 76853740
benzyl N-[3-(4-aminophenyl)phenyl]carbamate;hydrochloride (PubChem CID 76853740) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is benzyl N-[3-(4-aminophenyl)phenyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[3-(4-aminophenyl)phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 76853740 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | benzyl N-[3-(4-aminophenyl)phenyl]carbamate;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2cccc(NC(=O)OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C20H18N2O2.ClH/c21-18-11-9-16(10-12-18)17-7-4-8-19(13-17)22-20(23)24-14-15-5-2-1-3-6-15;/h1-13H,14,21H2,(H,22,23);1H |
| InChIKey | ZTPGIGBCBGOITA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|