C31H34N2O3Si — CID 10791831
(3-aminophenyl)methyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]carbamate (PubChem CID 10791831) has the molecular formula C31H34N2O3Si and a molecular weight of 510.71 g/mol. Its IUPAC name is (3-aminophenyl)methyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]carbamate.
| Compound Name | (3-aminophenyl)methyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 10791831 |
| Molecular Formula | C31H34N2O3Si |
| Molecular Weight | 510.71 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (3-aminophenyl)methyl N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]phenyl]carbamate |
| SMILES | CC(C)(C)[Si](OCc1cccc(NC(=O)OCc2cccc(N)c2)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34N2O3Si/c1-31(2,3)37(28-16-6-4-7-17-28,29-18-8-5-9-19-29)36-23-25-13-11-15-27(21-25)33-30(34)35-22-24-12-10-14-26(32)20-24/h4-21H,22-23,32H2,1-3H3,(H,33,34) |
| InChIKey | FHJCBPIJUFTINF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|