C34H41N2O3Si+ — CID 142425883
tert-butyl N-[1-benzyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-1-ium-4-yl]carbamate (PubChem CID 142425883) has the molecular formula C34H41N2O3Si+ and a molecular weight of 553.80 g/mol. Its IUPAC name is tert-butyl N-[1-benzyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-1-ium-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-benzyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-1-ium-4-yl]carbamate |
|---|---|
| PubChem CID | 142425883 |
| Molecular Formula | C34H41N2O3Si+ |
| Molecular Weight | 553.80 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | tert-butyl N-[1-benzyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]pyridin-1-ium-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc[n+](Cc2ccccc2)c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1 |
| InChI | InChI=1S/C34H40N2O3Si/c1-33(2,3)39-32(37)35-28-22-23-36(25-27-16-10-7-11-17-27)29(24-28)26-38-40(34(4,5)6,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h7-24H,25-26H2,1-6H3/p+1 |
| InChIKey | GWDWQOPXYQIFGW-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|