C26H36NO3Si+ — CID 102074695
tert-butyl 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-1-ium-1-carboxylate (PubChem CID 102074695) has the molecular formula C26H36NO3Si+ and a molecular weight of 438.66 g/mol. Its IUPAC name is tert-butyl 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-1-ium-1-carboxylate.
| Compound Name | tert-butyl 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 102074695 |
| Molecular Formula | C26H36NO3Si+ |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | tert-butyl 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C26H36NO3Si/c1-25(2,3)30-24(28)27-19-13-14-21(27)20-29-31(26(4,5)6,22-15-9-7-10-16-22)23-17-11-8-12-18-23/h7-12,15-18H,13-14,19-20H2,1-6H3/q+1 |
| InChIKey | JNYJTMDFCAAOPU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|