C47H65NO5Si2 — CID 46932889
tert-butyl (1S,2R,3R)-3-[bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]-2-hydroxycyclohexane-1-carboxylate (PubChem CID 46932889) has the molecular formula C47H65NO5Si2 and a molecular weight of 780.21 g/mol. Its IUPAC name is tert-butyl (1S,2R,3R)-3-[bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]-2-hydroxycyclohexane-1-carboxylate.
| Compound Name | tert-butyl (1S,2R,3R)-3-[bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]-2-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46932889 |
| Molecular Formula | C47H65NO5Si2 |
| Molecular Weight | 780.21 g/mol |
| Exact Mass | 779.44 |
| IUPAC Name | tert-butyl (1S,2R,3R)-3-[bis[2-[tert-butyl(diphenyl)silyl]oxyethyl]amino]-2-hydroxycyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCC[C@@H](N(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C47H65NO5Si2/c1-45(2,3)53-44(50)41-31-22-32-42(43(41)49)48(33-35-51-54(46(4,5)6,37-23-14-10-15-24-37)38-25-16-11-17-26-38)34-36-52-55(47(7,8)9,39-27-18-12-19-28-39)40-29-20-13-21-30-40/h10-21,23-30,41-43,49H,22,31-36H2,1-9H3/t41-,42+,43+/m0/s1 |
| InChIKey | REBPWJVPBHBIJP-VDXPIPGDSA-N |
| XLogP | 7.31 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.21 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|