C29H43NO4Si — CID 157218983
tert-butyl N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1R,2R)-2-hydroxycyclopentyl]propyl]carbamate (PubChem CID 157218983) has the molecular formula C29H43NO4Si and a molecular weight of 497.75 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1R,2R)-2-hydroxycyclopentyl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1R,2R)-2-hydroxycyclopentyl]propyl]carbamate |
|---|---|
| PubChem CID | 157218983 |
| Molecular Formula | C29H43NO4Si |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | tert-butyl N-[(1S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[(1R,2R)-2-hydroxycyclopentyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CCC[C@H]1O |
| InChI | InChI=1S/C29H43NO4Si/c1-28(2,3)34-27(32)30-25(24-18-13-19-26(24)31)20-21-33-35(29(4,5)6,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,24-26,31H,13,18-21H2,1-6H3,(H,30,32)/t24-,25+,26-/m1/s1 |
| InChIKey | RRBVOLUEKFYCMI-UODIDJSMSA-N |
| XLogP | 5.01 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|