C26H38INO4Si — CID 175133439
tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-iodo-3-methoxybutan-2-yl]carbamate (PubChem CID 175133439) has the molecular formula C26H38INO4Si and a molecular weight of 583.58 g/mol. Its IUPAC name is tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-iodo-3-methoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-iodo-3-methoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 175133439 |
| Molecular Formula | C26H38INO4Si |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | tert-butyl N-[4-[tert-butyl(diphenyl)silyl]oxy-1-iodo-3-methoxybutan-2-yl]carbamate |
| SMILES | COC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38INO4Si/c1-25(2,3)32-24(29)28-22(18-27)23(30-7)19-31-33(26(4,5)6,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-23H,18-19H2,1-7H3,(H,28,29) |
| InChIKey | RIOSIYQJNRUCFL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|