C25H34NO6SSi- — CID 23240416
(E)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ene-1-sulfonate (PubChem CID 23240416) has the molecular formula C25H34NO6SSi- and a molecular weight of 504.70 g/mol. Its IUPAC name is (E)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ene-1-sulfonate.
| Compound Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ene-1-sulfonate |
|---|---|
| PubChem CID | 23240416 |
| Molecular Formula | C25H34NO6SSi- |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]but-1-ene-1-sulfonate |
| SMILES | CC(C)(C)OC(=O)NC(/C=C/S(=O)(=O)[O-])CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H35NO6SSi/c1-24(2,3)32-23(27)26-20(17-18-33(28,29)30)19-31-34(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-18,20H,19H2,1-6H3,(H,26,27)(H,28,29,30)/p-1/b18-17+ |
| InChIKey | VUQVVTSKGHLGLV-ISLYRVAYSA-M |
| XLogP | 3.52 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|