C28H41NO5Si — CID 102155717
tert-butyl N-[(2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methyl-5-oxohexan-2-yl]carbamate (PubChem CID 102155717) has the molecular formula C28H41NO5Si and a molecular weight of 499.72 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methyl-5-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methyl-5-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 102155717 |
| Molecular Formula | C28H41NO5Si |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | tert-butyl N-[(2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methyl-5-oxohexan-2-yl]carbamate |
| SMILES | CC(=O)[C@@H](C)[C@H](O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41NO5Si/c1-20(21(2)30)25(31)24(29-26(32)34-27(3,4)5)19-33-35(28(6,7)8,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,20,24-25,31H,19H2,1-8H3,(H,29,32)/t20-,24-,25+/m1/s1 |
| InChIKey | QCXLUQSUXBSZBQ-ZPZUNKDASA-N |
| XLogP | 4.04 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|