C30H46O5Si — CID 10994868
tert-butyl (2R,3R,4R,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoate (PubChem CID 10994868) has the molecular formula C30H46O5Si and a molecular weight of 514.78 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoate.
| Compound Name | tert-butyl (2R,3R,4R,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoate |
|---|---|
| PubChem CID | 10994868 |
| Molecular Formula | C30H46O5Si |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | tert-butyl (2R,3R,4R,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-3,5-dihydroxy-2,4,6-trimethylheptanoate |
| SMILES | C[C@@H]([C@@H](O)[C@@H](C)C(=O)OC(C)(C)C)[C@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H46O5Si/c1-21(26(31)22(2)27(32)23(3)28(33)35-29(4,5)6)20-34-36(30(7,8)9,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,21-23,26-27,31-32H,20H2,1-9H3/t21-,22-,23-,26-,27-/m1/s1 |
| InChIKey | XPRMNDYYLPDHQM-YHZSJYEESA-N |
| XLogP | 4.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|