C21H28O3Si — CID 134973268
(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-methylbutanal (PubChem CID 134973268) has the molecular formula C21H28O3Si and a molecular weight of 356.54 g/mol. Its IUPAC name is (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-methylbutanal.
| Compound Name | (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-methylbutanal |
|---|---|
| PubChem CID | 134973268 |
| Molecular Formula | C21H28O3Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3-methylbutanal |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)C=O |
| InChI | InChI=1S/C21H28O3Si/c1-17(20(23)15-22)16-24-25(21(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-15,17,20,23H,16H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | MYECSJIECGEODS-YLJYHZDGSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|