C31H40O3Si — CID 71490044
(E,1R,4R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-1-phenylhept-2-ene-1,5-diol (PubChem CID 71490044) has the molecular formula C31H40O3Si and a molecular weight of 488.74 g/mol. Its IUPAC name is (E,1R,4R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-1-phenylhept-2-ene-1,5-diol.
| Compound Name | (E,1R,4R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-1-phenylhept-2-ene-1,5-diol |
|---|---|
| PubChem CID | 71490044 |
| Molecular Formula | C31H40O3Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (E,1R,4R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-1-phenylhept-2-ene-1,5-diol |
| SMILES | C[C@H](/C=C/[C@@H](O)c1ccccc1)[C@@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H40O3Si/c1-24(21-22-29(32)26-15-9-6-10-16-26)30(33)25(2)23-34-35(31(3,4)5,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-22,24-25,29-30,32-33H,23H2,1-5H3/b22-21+/t24-,25+,29-,30-/m1/s1 |
| InChIKey | CZIZFNTWOVTNEY-BWAVMFFQSA-N |
| XLogP | 5.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|