C26H36O2Si — CID 101020089
(2R,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyloct-5-yn-3-ol (PubChem CID 101020089) has the molecular formula C26H36O2Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (2R,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyloct-5-yn-3-ol.
| Compound Name | (2R,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyloct-5-yn-3-ol |
|---|---|
| PubChem CID | 101020089 |
| Molecular Formula | C26H36O2Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (2R,3S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyloct-5-yn-3-ol |
| SMILES | CCC#C[C@@H](C)[C@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O2Si/c1-7-8-15-21(2)25(27)22(3)20-28-29(26(4,5)6,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-14,16-19,21-22,25,27H,7,20H2,1-6H3/t21-,22-,25+/m1/s1 |
| InChIKey | ZQURURNLRGSRSR-RQTOMXEWSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|