C30H38O3Si — CID 14394625
(2S,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-3-phenylmethoxypentanal (PubChem CID 14394625) has the molecular formula C30H38O3Si and a molecular weight of 474.72 g/mol. Its IUPAC name is (2S,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-3-phenylmethoxypentanal.
| Compound Name | (2S,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-3-phenylmethoxypentanal |
|---|---|
| PubChem CID | 14394625 |
| Molecular Formula | C30H38O3Si |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | (2S,3R,4S)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethyl-3-phenylmethoxypentanal |
| SMILES | C[C@H](C=O)[C@H](OCc1ccccc1)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38O3Si/c1-24(21-31)29(32-23-26-15-9-6-10-16-26)25(2)22-33-34(30(3,4)5,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-21,24-25,29H,22-23H2,1-5H3/t24-,25+,29+/m1/s1 |
| InChIKey | OEYRZTABKMCDLO-AHPZMPFVSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|